C54H41N5Pt — CID 176643444
3-(2-carbazol-9-id-1-yl-1-phenylbenzimidazol-4-yl)-9,9-dimethyl-10-[4-(2-phenylpropan-2-yl)-2-pyridinyl]-4H-acridin-4-ide;platinum(2+) (PubChem CID 176643444) has the molecular formula C54H41N5Pt and a molecular weight of 955.04 g/mol. Its IUPAC name is 3-(2-carbazol-9-id-1-yl-1-phenylbenzimidazol-4-yl)-9,9-dimethyl-10-[4-(2-phenylpropan-2-yl)-2-pyridinyl]-4H-acridin-4-ide;platinum(2+).
| Compound Name | 3-(2-carbazol-9-id-1-yl-1-phenylbenzimidazol-4-yl)-9,9-dimethyl-10-[4-(2-phenylpropan-2-yl)-2-pyridinyl]-4H-acridin-4-ide;platinum(2+) |
|---|---|
| PubChem CID | 176643444 |
| Molecular Formula | C54H41N5Pt |
| Molecular Weight | 955.04 g/mol |
| Exact Mass | 954.30 |
| IUPAC Name | 3-(2-carbazol-9-id-1-yl-1-phenylbenzimidazol-4-yl)-9,9-dimethyl-10-[4-(2-phenylpropan-2-yl)-2-pyridinyl]-4H-acridin-4-ide;platinum(2+) |
| SMILES | CC(C)(c1ccccc1)c1ccnc(N2c3[c-]c(-c4cccc5c4nc(-c4cccc6c4[n-]c4ccccc46)n5-c4ccccc4)ccc3C(C)(C)c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C54H41N5.Pt/c1-53(2,36-17-7-5-8-18-36)37-31-32-55-49(34-37)59-46-27-14-12-25-43(46)54(3,4)44-30-29-35(33-48(44)59)39-22-16-28-47-51(39)57-52(58(47)38-19-9-6-10-20-38)42-24-15-23-41-40-21-11-13-26-45(40)56-50(41)42;/h5-32,34H,1-4H3;/q-2;+2 |
| InChIKey | OAFRRHNLZKRQHR-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 48.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.04 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|