C44H38N4O — CID 176644390
2-(2,2-dimethylpropyl)-8-[8-methyl-1-(10-propan-2-ylphenanthren-9-yl)imidazo[4,5-h]quinolin-2-yl]-[1]benzofuro[2,3-b]pyridine (PubChem CID 176644390) has the molecular formula C44H38N4O and a molecular weight of 638.82 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)-8-[8-methyl-1-(10-propan-2-ylphenanthren-9-yl)imidazo[4,5-h]quinolin-2-yl]-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2-(2,2-dimethylpropyl)-8-[8-methyl-1-(10-propan-2-ylphenanthren-9-yl)imidazo[4,5-h]quinolin-2-yl]-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 176644390 |
| Molecular Formula | C44H38N4O |
| Molecular Weight | 638.82 g/mol |
| Exact Mass | 638.30 |
| IUPAC Name | 2-(2,2-dimethylpropyl)-8-[8-methyl-1-(10-propan-2-ylphenanthren-9-yl)imidazo[4,5-h]quinolin-2-yl]-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2ccc3nc(-c4cccc5c4oc4nc(CC(C)(C)C)ccc45)n(-c4c(C(C)C)c5ccccc5c5ccccc45)c3c2n1 |
| InChI | InChI=1S/C44H38N4O/c1-25(2)37-31-14-9-7-12-29(31)30-13-8-10-15-32(30)39(37)48-40-36(23-20-27-19-18-26(3)45-38(27)40)47-42(48)35-17-11-16-33-34-22-21-28(24-44(4,5)6)46-43(34)49-41(33)35/h7-23,25H,24H2,1-6H3 |
| InChIKey | FJJRNDHTZJHPLJ-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.82 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|