C29H24FN3O4S2 — CID 176644551
5-[[5-benzyl-4-[3-fluoro-4-(2-methoxyethoxy)phenyl]-1,3-thiazol-2-yl]amino]-2-thiophen-2-ylpyridine-4-carboxylic acid (PubChem CID 176644551) has the molecular formula C29H24FN3O4S2 and a molecular weight of 561.66 g/mol. Its IUPAC name is 5-[[5-benzyl-4-[3-fluoro-4-(2-methoxyethoxy)phenyl]-1,3-thiazol-2-yl]amino]-2-thiophen-2-ylpyridine-4-carboxylic acid.
| Compound Name | 5-[[5-benzyl-4-[3-fluoro-4-(2-methoxyethoxy)phenyl]-1,3-thiazol-2-yl]amino]-2-thiophen-2-ylpyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 176644551 |
| Molecular Formula | C29H24FN3O4S2 |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | 5-[[5-benzyl-4-[3-fluoro-4-(2-methoxyethoxy)phenyl]-1,3-thiazol-2-yl]amino]-2-thiophen-2-ylpyridine-4-carboxylic acid |
| SMILES | COCCOc1ccc(-c2nc(Nc3cnc(-c4cccs4)cc3C(=O)O)sc2Cc2ccccc2)cc1F |
| InChI | InChI=1S/C29H24FN3O4S2/c1-36-11-12-37-24-10-9-19(15-21(24)30)27-26(14-18-6-3-2-4-7-18)39-29(33-27)32-23-17-31-22(16-20(23)28(34)35)25-8-5-13-38-25/h2-10,13,15-17H,11-12,14H2,1H3,(H,32,33)(H,34,35) |
| InChIKey | GYTZNSZPVKHMRM-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|