C41H30N4O2Si — CID 176647014
[4-[4-[3-(4,14-dioxa-6-azapentacyclo[11.7.0.02,10.03,7.015,20]icosa-1(13),2(10),3(7),5,8,11,15,17,19-nonaen-5-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-trimethylsilane (PubChem CID 176647014) has the molecular formula C41H30N4O2Si and a molecular weight of 638.80 g/mol. Its IUPAC name is [4-[4-[3-(4,14-dioxa-6-azapentacyclo[11.7.0.02,10.03,7.015,20]icosa-1(13),2(10),3(7),5,8,11,15,17,19-nonaen-5-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-trimethylsilane.
| Compound Name | [4-[4-[3-(4,14-dioxa-6-azapentacyclo[11.7.0.02,10.03,7.015,20]icosa-1(13),2(10),3(7),5,8,11,15,17,19-nonaen-5-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 176647014 |
| Molecular Formula | C41H30N4O2Si |
| Molecular Weight | 638.80 g/mol |
| Exact Mass | 638.21 |
| IUPAC Name | [4-[4-[3-(4,14-dioxa-6-azapentacyclo[11.7.0.02,10.03,7.015,20]icosa-1(13),2(10),3(7),5,8,11,15,17,19-nonaen-5-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4nc5ccc6ccc7oc8ccccc8c7c6c5o4)c3)n2)cc1 |
| InChI | InChI=1S/C41H30N4O2Si/c1-48(2,3)30-20-16-27(17-21-30)39-43-38(26-10-5-4-6-11-26)44-40(45-39)28-12-9-13-29(24-28)41-42-32-22-18-25-19-23-34-36(35(25)37(32)47-41)31-14-7-8-15-33(31)46-34/h4-24H,1-3H3 |
| InChIKey | JGKWPLFHTRRPGO-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.80 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|