C40H38Cl4Cu2N12 — CID 176648812
N,N'-bis[[1-[(4-phenyldiazenylphenyl)methyl]triazol-4-yl]methyl]octa-3,5-diyne-1,8-diamine;bis(dichlorocopper) (PubChem CID 176648812) has the molecular formula C40H38Cl4Cu2N12 and a molecular weight of 955.73 g/mol. Its IUPAC name is N,N'-bis[[1-[(4-phenyldiazenylphenyl)methyl]triazol-4-yl]methyl]octa-3,5-diyne-1,8-diamine;bis(dichlorocopper).
| Compound Name | N,N'-bis[[1-[(4-phenyldiazenylphenyl)methyl]triazol-4-yl]methyl]octa-3,5-diyne-1,8-diamine;bis(dichlorocopper) |
|---|---|
| PubChem CID | 176648812 |
| Molecular Formula | C40H38Cl4Cu2N12 |
| Molecular Weight | 955.73 g/mol |
| Exact Mass | 952.07 |
| IUPAC Name | N,N'-bis[[1-[(4-phenyldiazenylphenyl)methyl]triazol-4-yl]methyl]octa-3,5-diyne-1,8-diamine;bis(dichlorocopper) |
| SMILES | C(C#CCCNCc1cn(Cc2ccc(/N=N/c3ccccc3)cc2)nn1)#CCCNCc1cn(Cc2ccc(/N=N/c3ccccc3)cc2)nn1.Cl[Cu]Cl.Cl[Cu]Cl |
| InChI | InChI=1S/C40H38N12.4ClH.2Cu/c1(3-11-25-41-27-39-31-51(49-47-39)29-33-17-21-37(22-18-33)45-43-35-13-7-5-8-14-35)2-4-12-26-42-28-40-32-52(50-48-40)30-34-19-23-38(24-20-34)46-44-36-15-9-6-10-16-36;;;;;;/h5-10,13-24,31-32,41-42H,11-12,25-30H2;4*1H;;/q;;;;;2*+2/p-4/b45-43+,46-44+;;;;;; |
| InChIKey | RJXHUSAQDDOOLI-RSEBNOETSA-J |
| XLogP | 10.22 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.73 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|