C26H23F2N4O3P — CID 176650840
(1S,11R)-18-(difluoromethoxy)-5-(5-dimethylphosphoryl-2-pyridinyl)-12-methyl-8,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-2,4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 176650840) has the molecular formula C26H23F2N4O3P and a molecular weight of 508.47 g/mol. Its IUPAC name is (1S,11R)-18-(difluoromethoxy)-5-(5-dimethylphosphoryl-2-pyridinyl)-12-methyl-8,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-2,4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | (1S,11R)-18-(difluoromethoxy)-5-(5-dimethylphosphoryl-2-pyridinyl)-12-methyl-8,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-2,4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 176650840 |
| Molecular Formula | C26H23F2N4O3P |
| Molecular Weight | 508.47 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | (1S,11R)-18-(difluoromethoxy)-5-(5-dimethylphosphoryl-2-pyridinyl)-12-methyl-8,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-2,4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | CN1C(=O)c2cccc(OC(F)F)c2[C@H]2C[C@@H]1c1nn3ccc(-c4ccc(P(C)(C)=O)cn4)cc3c12 |
| InChI | InChI=1S/C26H23F2N4O3P/c1-31-20-12-17(22-16(25(31)33)5-4-6-21(22)35-26(27)28)23-19-11-14(9-10-32(19)30-24(20)23)18-8-7-15(13-29-18)36(2,3)34/h4-11,13,17,20,26H,12H2,1-3H3/t17-,20-/m1/s1 |
| InChIKey | LQTRMUPGOIJQQW-YLJYHZDGSA-N |
| XLogP | 4.91 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|