C26H22F3N4O3P — CID 176651062
(1S,11R)-18-(difluoromethoxy)-5-(6-dimethylphosphoryl-3-pyridinyl)-6-fluoro-12-methyl-8,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-2,4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 176651062) has the molecular formula C26H22F3N4O3P and a molecular weight of 526.46 g/mol. Its IUPAC name is (1S,11R)-18-(difluoromethoxy)-5-(6-dimethylphosphoryl-3-pyridinyl)-6-fluoro-12-methyl-8,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-2,4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | (1S,11R)-18-(difluoromethoxy)-5-(6-dimethylphosphoryl-3-pyridinyl)-6-fluoro-12-methyl-8,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-2,4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 176651062 |
| Molecular Formula | C26H22F3N4O3P |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | (1S,11R)-18-(difluoromethoxy)-5-(6-dimethylphosphoryl-3-pyridinyl)-6-fluoro-12-methyl-8,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-2,4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | CN1C(=O)c2cccc(OC(F)F)c2[C@H]2C[C@@H]1c1nn3cc(F)c(-c4ccc(P(C)(C)=O)nc4)cc3c12 |
| InChI | InChI=1S/C26H22F3N4O3P/c1-32-19-10-16(22-14(25(32)34)5-4-6-20(22)36-26(28)29)23-18-9-15(17(27)12-33(18)31-24(19)23)13-7-8-21(30-11-13)37(2,3)35/h4-9,11-12,16,19,26H,10H2,1-3H3/t16-,19-/m1/s1 |
| InChIKey | XFJVSBVHWZJAAQ-VQIMIIECSA-N |
| XLogP | 5.05 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|