C21H27N4NaOS2 — CID 176652528
sodium 5-[(3S)-3-[[(R)-tert-butylsulfinyl]amino]spiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]pyrazine-2-thiolate (PubChem CID 176652528) has the molecular formula C21H27N4NaOS2 and a molecular weight of 438.60 g/mol. Its IUPAC name is sodium 5-[(3S)-3-[[(R)-tert-butylsulfinyl]amino]spiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]pyrazine-2-thiolate.
| Compound Name | sodium 5-[(3S)-3-[[(R)-tert-butylsulfinyl]amino]spiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]pyrazine-2-thiolate |
|---|---|
| PubChem CID | 176652528 |
| Molecular Formula | C21H27N4NaOS2 |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | sodium 5-[(3S)-3-[[(R)-tert-butylsulfinyl]amino]spiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]pyrazine-2-thiolate |
| SMILES | CC(C)(C)[S@@](=O)N[C@@H]1c2ccccc2C(c2cnc([S-])cn2)C12CCNCC2.[Na+] |
| InChI | InChI=1S/C21H28N4OS2.Na/c1-20(2,3)28(26)25-19-15-7-5-4-6-14(15)18(16-12-24-17(27)13-23-16)21(19)8-10-22-11-9-21;/h4-7,12-13,18-19,22,25H,8-11H2,1-3H3,(H,24,27);/q;+1/p-1/t18?,19-,28-;/m1./s1 |
| InChIKey | IAWXTBHEUSVJNF-GLVIZWHLSA-M |
| XLogP | -0.01 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|