C17H25N5OS — CID 167048005
2-methyl-N-[(5S)-spiro[1,10,11-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-4,4'-piperidine]-5-yl]propane-2-sulfinamide (PubChem CID 167048005) has the molecular formula C17H25N5OS and a molecular weight of 347.49 g/mol. Its IUPAC name is 2-methyl-N-[(5S)-spiro[1,10,11-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-4,4'-piperidine]-5-yl]propane-2-sulfinamide.
| Compound Name | 2-methyl-N-[(5S)-spiro[1,10,11-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-4,4'-piperidine]-5-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 167048005 |
| Molecular Formula | C17H25N5OS |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-methyl-N-[(5S)-spiro[1,10,11-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-4,4'-piperidine]-5-yl]propane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N[C@@H]1c2ccc3nncn3c2CC12CCNCC2 |
| InChI | InChI=1S/C17H25N5OS/c1-16(2,3)24(23)21-15-12-4-5-14-20-19-11-22(14)13(12)10-17(15)6-8-18-9-7-17/h4-5,11,15,18,21H,6-10H2,1-3H3/t15-,24?/m1/s1 |
| InChIKey | NPZUFTGILPQSJJ-GZAIGYLVSA-N |
| XLogP | 1.75 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |