C21H28N2O3S — CID 171454761
methyl 3-[(3S)-3-[[(R)-tert-butylsulfinyl]amino]spiro[1,3-dihydroindene-2,4'-piperidine]-5-yl]prop-2-ynoate (PubChem CID 171454761) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is methyl 3-[(3S)-3-[[(R)-tert-butylsulfinyl]amino]spiro[1,3-dihydroindene-2,4'-piperidine]-5-yl]prop-2-ynoate.
| Compound Name | methyl 3-[(3S)-3-[[(R)-tert-butylsulfinyl]amino]spiro[1,3-dihydroindene-2,4'-piperidine]-5-yl]prop-2-ynoate |
|---|---|
| PubChem CID | 171454761 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | methyl 3-[(3S)-3-[[(R)-tert-butylsulfinyl]amino]spiro[1,3-dihydroindene-2,4'-piperidine]-5-yl]prop-2-ynoate |
| SMILES | COC(=O)C#Cc1ccc2c(c1)[C@@H](N[S@](=O)C(C)(C)C)C1(CCNCC1)C2 |
| InChI | InChI=1S/C21H28N2O3S/c1-20(2,3)27(25)23-19-17-13-15(6-8-18(24)26-4)5-7-16(17)14-21(19)9-11-22-12-10-21/h5,7,13,19,22-23H,9-12,14H2,1-4H3/t19-,27-/m1/s1 |
| InChIKey | NSSPJNUOZNRKSL-XHCCPWGMSA-N |
| XLogP | 2.23 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|