C18H25N3S — CID 167048203
3-(tert-butylsulfanylamino)spiro[1,3-dihydroindene-2,4'-piperidine]-5-carbonitrile (PubChem CID 167048203) has the molecular formula C18H25N3S and a molecular weight of 315.49 g/mol. Its IUPAC name is 3-(tert-butylsulfanylamino)spiro[1,3-dihydroindene-2,4'-piperidine]-5-carbonitrile.
| Compound Name | 3-(tert-butylsulfanylamino)spiro[1,3-dihydroindene-2,4'-piperidine]-5-carbonitrile |
|---|---|
| PubChem CID | 167048203 |
| Molecular Formula | C18H25N3S |
| Molecular Weight | 315.49 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 3-(tert-butylsulfanylamino)spiro[1,3-dihydroindene-2,4'-piperidine]-5-carbonitrile |
| SMILES | CC(C)(C)SNC1c2cc(C#N)ccc2CC12CCNCC2 |
| InChI | InChI=1S/C18H25N3S/c1-17(2,3)22-21-16-15-10-13(12-19)4-5-14(15)11-18(16)6-8-20-9-7-18/h4-5,10,16,20-21H,6-9,11H2,1-3H3 |
| InChIKey | HUEMXUGCIFDQKP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|