C19H26BrN3OS — CID 175094156
[[(1S)-1'-(bromomethyl)-6-cyanospiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]amino]-tert-butyl-oxidosulfanium (PubChem CID 175094156) has the molecular formula C19H26BrN3OS and a molecular weight of 424.41 g/mol. Its IUPAC name is [[(1S)-1'-(bromomethyl)-6-cyanospiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(1S)-1'-(bromomethyl)-6-cyanospiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 175094156 |
| Molecular Formula | C19H26BrN3OS |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | [[(1S)-1'-(bromomethyl)-6-cyanospiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]amino]-tert-butyl-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@@H]1c2cc(C#N)ccc2CC12CCN(CBr)CC2 |
| InChI | InChI=1S/C19H26BrN3OS/c1-18(2,3)25(24)22-17-16-10-14(12-21)4-5-15(16)11-19(17)6-8-23(13-20)9-7-19/h4-5,10,17,22H,6-9,11,13H2,1-3H3/t17-,25?/m1/s1 |
| InChIKey | FSFSZWIHFIIYBV-SMFUYQKNSA-N |
| XLogP | 3.64 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|