C18H24F2N2O3S — CID 174055742
tert-butyl-[[(1S)-1'-carboxy-5,6-difluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]amino]-oxidosulfanium (PubChem CID 174055742) has the molecular formula C18H24F2N2O3S and a molecular weight of 386.46 g/mol. Its IUPAC name is tert-butyl-[[(1S)-1'-carboxy-5,6-difluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1S)-1'-carboxy-5,6-difluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 174055742 |
| Molecular Formula | C18H24F2N2O3S |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | tert-butyl-[[(1S)-1'-carboxy-5,6-difluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@@H]1c2cc(F)c(F)cc2CC12CCN(C(=O)O)CC2 |
| InChI | InChI=1S/C18H24F2N2O3S/c1-17(2,3)26(25)21-15-12-9-14(20)13(19)8-11(12)10-18(15)4-6-22(7-5-18)16(23)24/h8-9,15,21H,4-7,10H2,1-3H3,(H,23,24)/t15-,26?/m1/s1 |
| InChIKey | RACWRAPDIWYSQW-GJNAARLKSA-N |
| XLogP | 3.37 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|