C27H39N5O2SSi — CID 174230746
[[(1S)-1'-(4-amino-1-methyl-6-oxopyrimidin-2-yl)-5-(2-trimethylsilylethynyl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]amino]-tert-butyl-oxidosulfanium (PubChem CID 174230746) has the molecular formula C27H39N5O2SSi and a molecular weight of 525.80 g/mol. Its IUPAC name is [[(1S)-1'-(4-amino-1-methyl-6-oxopyrimidin-2-yl)-5-(2-trimethylsilylethynyl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(1S)-1'-(4-amino-1-methyl-6-oxopyrimidin-2-yl)-5-(2-trimethylsilylethynyl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 174230746 |
| Molecular Formula | C27H39N5O2SSi |
| Molecular Weight | 525.80 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | [[(1S)-1'-(4-amino-1-methyl-6-oxopyrimidin-2-yl)-5-(2-trimethylsilylethynyl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]amino]-tert-butyl-oxidosulfanium |
| SMILES | Cn1c(N2CCC3(CC2)Cc2cc(C#C[Si](C)(C)C)ccc2[C@H]3N[S+]([O-])C(C)(C)C)nc(N)cc1=O |
| InChI | InChI=1S/C27H39N5O2SSi/c1-26(2,3)35(34)30-24-21-9-8-19(10-15-36(5,6)7)16-20(21)18-27(24)11-13-32(14-12-27)25-29-22(28)17-23(33)31(25)4/h8-9,16-17,24,30H,11-14,18,28H2,1-7H3/t24-,35?/m1/s1 |
| InChIKey | CUEOVQOHWUEDKJ-YAYCPNDQSA-N |
| XLogP | 3.53 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.80 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|