C25H34F2N4O2SSi — CID 174056261
tert-butyl-[1-[2-(4,4-difluoropiperidin-1-yl)-3-methyl-4-oxo-6-(2-trimethylsilylethynyl)quinazolin-8-yl]ethylideneamino]-oxidosulfanium (PubChem CID 174056261) has the molecular formula C25H34F2N4O2SSi and a molecular weight of 520.72 g/mol. Its IUPAC name is tert-butyl-[1-[2-(4,4-difluoropiperidin-1-yl)-3-methyl-4-oxo-6-(2-trimethylsilylethynyl)quinazolin-8-yl]ethylideneamino]-oxidosulfanium.
| Compound Name | tert-butyl-[1-[2-(4,4-difluoropiperidin-1-yl)-3-methyl-4-oxo-6-(2-trimethylsilylethynyl)quinazolin-8-yl]ethylideneamino]-oxidosulfanium |
|---|---|
| PubChem CID | 174056261 |
| Molecular Formula | C25H34F2N4O2SSi |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | tert-butyl-[1-[2-(4,4-difluoropiperidin-1-yl)-3-methyl-4-oxo-6-(2-trimethylsilylethynyl)quinazolin-8-yl]ethylideneamino]-oxidosulfanium |
| SMILES | CC(=N[S+]([O-])C(C)(C)C)c1cc(C#C[Si](C)(C)C)cc2c(=O)n(C)c(N3CCC(F)(F)CC3)nc12 |
| InChI | InChI=1S/C25H34F2N4O2SSi/c1-17(29-34(33)24(2,3)4)19-15-18(9-14-35(6,7)8)16-20-21(19)28-23(30(5)22(20)32)31-12-10-25(26,27)11-13-31/h15-16H,10-13H2,1-8H3 |
| InChIKey | CWBPQGXNGHNXON-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|