About 6-bromo-2-(4,4-difluoropiperidin-1-yl)-8-iodo-3-methylquinazolin-4-one
6-bromo-2-(4,4-difluoropiperidin-1-yl)-8-iodo-3-methylquinazolin-4-one (PubChem CID 169212493) has the molecular formula C14H13BrF2IN3O
and a molecular weight of 484.08 g/mol. Its IUPAC name is 6-bromo-2-(4,4-difluoropiperidin-1-yl)-8-iodo-3-methylquinazolin-4-one.
Molecular Properties
| Compound Name | 6-bromo-2-(4,4-difluoropiperidin-1-yl)-8-iodo-3-methylquinazolin-4-one |
| PubChem CID | 169212493 |
| Molecular Formula | C14H13BrF2IN3O |
| Molecular Weight | 484.08 g/mol |
| Exact Mass | 482.93 |
| IUPAC Name | 6-bromo-2-(4,4-difluoropiperidin-1-yl)-8-iodo-3-methylquinazolin-4-one |
| SMILES | Cn1c(N2CCC(F)(F)CC2)nc2c(I)cc(Br)cc2c1=O |
| InChI | InChI=1S/C14H13BrF2IN3O/c1-20-12(22)9-6-8(15)7-10(18)11(9)19-13(20)21-4-2-14(16,17)3-5-21/h6-7H,2-5H2,1H3 |
| InChIKey | WOVZZLNXGNARBV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.08 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2-(4,4-difluoropiperidin-1-yl)-8-iodo-3-methylquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(4,4-difluoropiperidin-1-yl)-8-iodo-3-methylquinazolin-4-one?
The IUPAC name of 6-bromo-2-(4,4-difluoropiperidin-1-yl)-8-iodo-3-methylquinazolin-4-one (CID 169212493) is 6-bromo-2-(4,4-difluoropiperidin-1-yl)-8-iodo-3-methylquinazolin-4-one.
What is the SMILES notation for 6-bromo-2-(4,4-difluoropiperidin-1-yl)-8-iodo-3-methylquinazolin-4-one?
The canonical SMILES for 6-bromo-2-(4,4-difluoropiperidin-1-yl)-8-iodo-3-methylquinazolin-4-one is Cn1c(N2CCC(F)(F)CC2)nc2c(I)cc(Br)cc2c1=O.
What is the InChIKey of 6-bromo-2-(4,4-difluoropiperidin-1-yl)-8-iodo-3-methylquinazolin-4-one?
The InChIKey is WOVZZLNXGNARBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrF2IN3O/c1-20-12(22)9-6-8(15)7-10(18)11(9)19-13(20)21-4-2-14(16,17)3-5-21/h6-7H,2-5H2,1H3.
What are the key properties of 6-bromo-2-(4,4-difluoropiperidin-1-yl)-8-iodo-3-methylquinazolin-4-one?
6-bromo-2-(4,4-difluoropiperidin-1-yl)-8-iodo-3-methylquinazolin-4-one has a molecular weight of 484.08 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(4,4-difluoropiperidin-1-yl)-8-iodo-3-methylquinazolin-4-one is sourced from PubChem (CID 169212493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).