C14H13BrF2IN3O — CID 169212493
6-bromo-2-(4,4-difluoropiperidin-1-yl)-8-iodo-3-methylquinazolin-4-one (PubChem CID 169212493) has the molecular formula C14H13BrF2IN3O and a molecular weight of 484.08 g/mol. Its IUPAC name is 6-bromo-2-(4,4-difluoropiperidin-1-yl)-8-iodo-3-methylquinazolin-4-one.
| Compound Name | 6-bromo-2-(4,4-difluoropiperidin-1-yl)-8-iodo-3-methylquinazolin-4-one |
|---|---|
| PubChem CID | 169212493 |
| Molecular Formula | C14H13BrF2IN3O |
| Molecular Weight | 484.08 g/mol |
| Exact Mass | 482.93 |
| IUPAC Name | 6-bromo-2-(4,4-difluoropiperidin-1-yl)-8-iodo-3-methylquinazolin-4-one |
| SMILES | Cn1c(N2CCC(F)(F)CC2)nc2c(I)cc(Br)cc2c1=O |
| InChI | InChI=1S/C14H13BrF2IN3O/c1-20-12(22)9-6-8(15)7-10(18)11(9)19-13(20)21-4-2-14(16,17)3-5-21/h6-7H,2-5H2,1H3 |
| InChIKey | WOVZZLNXGNARBV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.08 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|