C16H20BrN3O2 — CID 170753277
8-(1-bromoethyl)-3,6-dimethyl-2-morpholin-4-ylquinazolin-4-one (PubChem CID 170753277) has the molecular formula C16H20BrN3O2 and a molecular weight of 366.26 g/mol. Its IUPAC name is 8-(1-bromoethyl)-3,6-dimethyl-2-morpholin-4-ylquinazolin-4-one.
| Compound Name | 8-(1-bromoethyl)-3,6-dimethyl-2-morpholin-4-ylquinazolin-4-one |
|---|---|
| PubChem CID | 170753277 |
| Molecular Formula | C16H20BrN3O2 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 8-(1-bromoethyl)-3,6-dimethyl-2-morpholin-4-ylquinazolin-4-one |
| SMILES | Cc1cc(C(C)Br)c2nc(N3CCOCC3)n(C)c(=O)c2c1 |
| InChI | InChI=1S/C16H20BrN3O2/c1-10-8-12(11(2)17)14-13(9-10)15(21)19(3)16(18-14)20-4-6-22-7-5-20/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | YJLPYJDOJBZOOE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|