C24H31N4O3P — CID 170753683
8-[1-(2-dimethylphosphorylanilino)ethyl]-3,6-dimethyl-2-morpholin-4-ylquinazolin-4-one (PubChem CID 170753683) has the molecular formula C24H31N4O3P and a molecular weight of 454.51 g/mol. Its IUPAC name is 8-[1-(2-dimethylphosphorylanilino)ethyl]-3,6-dimethyl-2-morpholin-4-ylquinazolin-4-one.
| Compound Name | 8-[1-(2-dimethylphosphorylanilino)ethyl]-3,6-dimethyl-2-morpholin-4-ylquinazolin-4-one |
|---|---|
| PubChem CID | 170753683 |
| Molecular Formula | C24H31N4O3P |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 8-[1-(2-dimethylphosphorylanilino)ethyl]-3,6-dimethyl-2-morpholin-4-ylquinazolin-4-one |
| SMILES | Cc1cc(C(C)Nc2ccccc2P(C)(C)=O)c2nc(N3CCOCC3)n(C)c(=O)c2c1 |
| InChI | InChI=1S/C24H31N4O3P/c1-16-14-18(17(2)25-20-8-6-7-9-21(20)32(4,5)30)22-19(15-16)23(29)27(3)24(26-22)28-10-12-31-13-11-28/h6-9,14-15,17,25H,10-13H2,1-5H3 |
| InChIKey | CWSDPIVBVIDBAN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|