C21H32N4O3S — CID 175998947
tert-butyl-[[(1R)-1-(3,6-dimethyl-2-morpholin-4-yl-4-oxoquinazolin-8-yl)propyl]amino]-oxidosulfanium (PubChem CID 175998947) has the molecular formula C21H32N4O3S and a molecular weight of 420.58 g/mol. Its IUPAC name is tert-butyl-[[(1R)-1-(3,6-dimethyl-2-morpholin-4-yl-4-oxoquinazolin-8-yl)propyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1R)-1-(3,6-dimethyl-2-morpholin-4-yl-4-oxoquinazolin-8-yl)propyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175998947 |
| Molecular Formula | C21H32N4O3S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | tert-butyl-[[(1R)-1-(3,6-dimethyl-2-morpholin-4-yl-4-oxoquinazolin-8-yl)propyl]amino]-oxidosulfanium |
| SMILES | CC[C@@H](N[S+]([O-])C(C)(C)C)c1cc(C)cc2c(=O)n(C)c(N3CCOCC3)nc12 |
| InChI | InChI=1S/C21H32N4O3S/c1-7-17(23-29(27)21(3,4)5)15-12-14(2)13-16-18(15)22-20(24(6)19(16)26)25-8-10-28-11-9-25/h12-13,17,23H,7-11H2,1-6H3/t17-,29?/m1/s1 |
| InChIKey | FKFQJHZXNMFLGI-RLDYEDSHSA-N |
| XLogP | 2.58 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|