C23H36N4O2S — CID 174317987
tert-butyl-[1-[2-(4,4-dimethylpiperidin-1-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-oxidosulfanium (PubChem CID 174317987) has the molecular formula C23H36N4O2S and a molecular weight of 432.63 g/mol. Its IUPAC name is tert-butyl-[1-[2-(4,4-dimethylpiperidin-1-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-oxidosulfanium.
| Compound Name | tert-butyl-[1-[2-(4,4-dimethylpiperidin-1-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-oxidosulfanium |
|---|---|
| PubChem CID | 174317987 |
| Molecular Formula | C23H36N4O2S |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | tert-butyl-[1-[2-(4,4-dimethylpiperidin-1-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-oxidosulfanium |
| SMILES | Cc1cc(C(C)N[S+]([O-])C(C)(C)C)c2nc(N3CCC(C)(C)CC3)n(C)c(=O)c2c1 |
| InChI | InChI=1S/C23H36N4O2S/c1-15-13-17(16(2)25-30(29)22(3,4)5)19-18(14-15)20(28)26(8)21(24-19)27-11-9-23(6,7)10-12-27/h13-14,16,25H,9-12H2,1-8H3 |
| InChIKey | VLJPNDODNAUOON-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|