C15H18BrN3O — CID 169155300
8-bromo-3,6-dimethyl-2-piperidin-1-ylquinazolin-4-one (PubChem CID 169155300) has the molecular formula C15H18BrN3O and a molecular weight of 336.23 g/mol. Its IUPAC name is 8-bromo-3,6-dimethyl-2-piperidin-1-ylquinazolin-4-one.
| Compound Name | 8-bromo-3,6-dimethyl-2-piperidin-1-ylquinazolin-4-one |
|---|---|
| PubChem CID | 169155300 |
| Molecular Formula | C15H18BrN3O |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 8-bromo-3,6-dimethyl-2-piperidin-1-ylquinazolin-4-one |
| SMILES | Cc1cc(Br)c2nc(N3CCCCC3)n(C)c(=O)c2c1 |
| InChI | InChI=1S/C15H18BrN3O/c1-10-8-11-13(12(16)9-10)17-15(18(2)14(11)20)19-6-4-3-5-7-19/h8-9H,3-7H2,1-2H3 |
| InChIKey | UFGVHPAEHCVAEG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |