C12H14BrN3OS — CID 169155375
7-bromo-3-methyl-2-piperidin-1-ylthieno[3,2-d]pyrimidin-4-one (PubChem CID 169155375) has the molecular formula C12H14BrN3OS and a molecular weight of 328.24 g/mol. Its IUPAC name is 7-bromo-3-methyl-2-piperidin-1-ylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 7-bromo-3-methyl-2-piperidin-1-ylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 169155375 |
| Molecular Formula | C12H14BrN3OS |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 7-bromo-3-methyl-2-piperidin-1-ylthieno[3,2-d]pyrimidin-4-one |
| SMILES | Cn1c(N2CCCCC2)nc2c(Br)csc2c1=O |
| InChI | InChI=1S/C12H14BrN3OS/c1-15-11(17)10-9(8(13)7-18-10)14-12(15)16-5-3-2-4-6-16/h7H,2-6H2,1H3 |
| InChIKey | YAPZQNCFIPNFRG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |