About 1-(3-methyl-4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-7-yl)ethyl methanesulfonate
1-(3-methyl-4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-7-yl)ethyl methanesulfonate (PubChem CID 169155125) has the molecular formula C15H21N3O4S2
and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-(3-methyl-4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-7-yl)ethyl methanesulfonate.
Molecular Properties
| Compound Name | 1-(3-methyl-4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-7-yl)ethyl methanesulfonate |
| PubChem CID | 169155125 |
| Molecular Formula | C15H21N3O4S2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 1-(3-methyl-4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-7-yl)ethyl methanesulfonate |
| SMILES | CC(OS(C)(=O)=O)c1csc2c(=O)n(C)c(N3CCCCC3)nc12 |
| InChI | InChI=1S/C15H21N3O4S2/c1-10(22-24(3,20)21)11-9-23-13-12(11)16-15(17(2)14(13)19)18-7-5-4-6-8-18/h9-10H,4-8H2,1-3H3 |
| InChIKey | LMXRUCSEAWZXFR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methyl-4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-7-yl)ethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methyl-4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-7-yl)ethyl methanesulfonate?
The IUPAC name of 1-(3-methyl-4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-7-yl)ethyl methanesulfonate (CID 169155125) is 1-(3-methyl-4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-7-yl)ethyl methanesulfonate.
What is the SMILES notation for 1-(3-methyl-4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-7-yl)ethyl methanesulfonate?
The canonical SMILES for 1-(3-methyl-4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-7-yl)ethyl methanesulfonate is CC(OS(C)(=O)=O)c1csc2c(=O)n(C)c(N3CCCCC3)nc12.
What is the InChIKey of 1-(3-methyl-4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-7-yl)ethyl methanesulfonate?
The InChIKey is LMXRUCSEAWZXFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O4S2/c1-10(22-24(3,20)21)11-9-23-13-12(11)16-15(17(2)14(13)19)18-7-5-4-6-8-18/h9-10H,4-8H2,1-3H3.
What are the key properties of 1-(3-methyl-4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-7-yl)ethyl methanesulfonate?
1-(3-methyl-4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-7-yl)ethyl methanesulfonate has a molecular weight of 371.48 g/mol, XLogP of 2.02, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methyl-4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-7-yl)ethyl methanesulfonate is sourced from PubChem (CID 169155125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).