C15H21N3O4S2 — CID 169155125
1-(3-methyl-4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-7-yl)ethyl methanesulfonate (PubChem CID 169155125) has the molecular formula C15H21N3O4S2 and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-(3-methyl-4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-7-yl)ethyl methanesulfonate.
| Compound Name | 1-(3-methyl-4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-7-yl)ethyl methanesulfonate |
|---|---|
| PubChem CID | 169155125 |
| Molecular Formula | C15H21N3O4S2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 1-(3-methyl-4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-7-yl)ethyl methanesulfonate |
| SMILES | CC(OS(C)(=O)=O)c1csc2c(=O)n(C)c(N3CCCCC3)nc12 |
| InChI | InChI=1S/C15H21N3O4S2/c1-10(22-24(3,20)21)11-9-23-13-12(11)16-15(17(2)14(13)19)18-7-5-4-6-8-18/h9-10H,4-8H2,1-3H3 |
| InChIKey | LMXRUCSEAWZXFR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|