C16H17F3N4O — CID 169155198
2-(4,4-difluoropiperidin-1-yl)-8-ethanimidoyl-6-fluoro-3-methylquinazolin-4-one (PubChem CID 169155198) has the molecular formula C16H17F3N4O and a molecular weight of 338.33 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)-8-ethanimidoyl-6-fluoro-3-methylquinazolin-4-one.
| Compound Name | 2-(4,4-difluoropiperidin-1-yl)-8-ethanimidoyl-6-fluoro-3-methylquinazolin-4-one |
|---|---|
| PubChem CID | 169155198 |
| Molecular Formula | C16H17F3N4O |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)-8-ethanimidoyl-6-fluoro-3-methylquinazolin-4-one |
| SMILES | [H]/N=C(\C)c1cc(F)cc2c(=O)n(C)c(N3CCC(F)(F)CC3)nc12 |
| InChI | InChI=1S/C16H17F3N4O/c1-9(20)11-7-10(17)8-12-13(11)21-15(22(2)14(12)24)23-5-3-16(18,19)4-6-23/h7-8,20H,3-6H2,1-2H3/b20-9+ |
| InChIKey | RCAYBJLXAQLODK-AWQFTUOYSA-N |
| XLogP | 2.70 |
| TPSA | 61.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|