C19H24ClF2N5O2S — CID 174056299
tert-butyl-[1-[6-chloro-2-(4,4-difluoropiperidin-1-yl)-3-methyl-4-oxopyrido[3,2-d]pyrimidin-8-yl]ethylideneamino]-oxidosulfanium (PubChem CID 174056299) has the molecular formula C19H24ClF2N5O2S and a molecular weight of 459.95 g/mol. Its IUPAC name is tert-butyl-[1-[6-chloro-2-(4,4-difluoropiperidin-1-yl)-3-methyl-4-oxopyrido[3,2-d]pyrimidin-8-yl]ethylideneamino]-oxidosulfanium.
| Compound Name | tert-butyl-[1-[6-chloro-2-(4,4-difluoropiperidin-1-yl)-3-methyl-4-oxopyrido[3,2-d]pyrimidin-8-yl]ethylideneamino]-oxidosulfanium |
|---|---|
| PubChem CID | 174056299 |
| Molecular Formula | C19H24ClF2N5O2S |
| Molecular Weight | 459.95 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | tert-butyl-[1-[6-chloro-2-(4,4-difluoropiperidin-1-yl)-3-methyl-4-oxopyrido[3,2-d]pyrimidin-8-yl]ethylideneamino]-oxidosulfanium |
| SMILES | CC(=N[S+]([O-])C(C)(C)C)c1cc(Cl)nc2c(=O)n(C)c(N3CCC(F)(F)CC3)nc12 |
| InChI | InChI=1S/C19H24ClF2N5O2S/c1-11(25-30(29)18(2,3)4)12-10-13(20)23-15-14(12)24-17(26(5)16(15)28)27-8-6-19(21,22)7-9-27/h10H,6-9H2,1-5H3 |
| InChIKey | PNCPMKCESONRJS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 86.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.95 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|