C20H25N5O2S — CID 174056402
tert-butyl-[1-[3,6-dimethyl-2-(2-methylpyrazol-3-yl)-4-oxoquinazolin-8-yl]ethylideneamino]-oxidosulfanium (PubChem CID 174056402) has the molecular formula C20H25N5O2S and a molecular weight of 399.52 g/mol. Its IUPAC name is tert-butyl-[1-[3,6-dimethyl-2-(2-methylpyrazol-3-yl)-4-oxoquinazolin-8-yl]ethylideneamino]-oxidosulfanium.
| Compound Name | tert-butyl-[1-[3,6-dimethyl-2-(2-methylpyrazol-3-yl)-4-oxoquinazolin-8-yl]ethylideneamino]-oxidosulfanium |
|---|---|
| PubChem CID | 174056402 |
| Molecular Formula | C20H25N5O2S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | tert-butyl-[1-[3,6-dimethyl-2-(2-methylpyrazol-3-yl)-4-oxoquinazolin-8-yl]ethylideneamino]-oxidosulfanium |
| SMILES | CC(=N[S+]([O-])C(C)(C)C)c1cc(C)cc2c(=O)n(C)c(-c3ccnn3C)nc12 |
| InChI | InChI=1S/C20H25N5O2S/c1-12-10-14(13(2)23-28(27)20(3,4)5)17-15(11-12)19(26)24(6)18(22-17)16-8-9-21-25(16)7/h8-11H,1-7H3 |
| InChIKey | KSGABNSJYBUBDO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|