C18H25N3O2S — CID 169154611
(NZ,R)-N-[1-(2-ethyl-3,6-dimethyl-4-oxoquinazolin-8-yl)ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 169154611) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is (NZ,R)-N-[1-(2-ethyl-3,6-dimethyl-4-oxoquinazolin-8-yl)ethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NZ,R)-N-[1-(2-ethyl-3,6-dimethyl-4-oxoquinazolin-8-yl)ethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 169154611 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (NZ,R)-N-[1-(2-ethyl-3,6-dimethyl-4-oxoquinazolin-8-yl)ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CCc1nc2c(/C(C)=N\[S@](=O)C(C)(C)C)cc(C)cc2c(=O)n1C |
| InChI | InChI=1S/C18H25N3O2S/c1-8-15-19-16-13(12(3)20-24(23)18(4,5)6)9-11(2)10-14(16)17(22)21(15)7/h9-10H,8H2,1-7H3/b20-12-/t24-/m1/s1 |
| InChIKey | UPRHCIPFRJXGRJ-WCNLKWBDSA-N |
| XLogP | 3.08 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|