C24H26N4O2S — CID 174056409
tert-butyl-[1-[2-(1H-indol-2-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylideneamino]-oxidosulfanium (PubChem CID 174056409) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is tert-butyl-[1-[2-(1H-indol-2-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylideneamino]-oxidosulfanium.
| Compound Name | tert-butyl-[1-[2-(1H-indol-2-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylideneamino]-oxidosulfanium |
|---|---|
| PubChem CID | 174056409 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | tert-butyl-[1-[2-(1H-indol-2-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylideneamino]-oxidosulfanium |
| SMILES | CC(=N[S+]([O-])C(C)(C)C)c1cc(C)cc2c(=O)n(C)c(-c3cc4ccccc4[nH]3)nc12 |
| InChI | InChI=1S/C24H26N4O2S/c1-14-11-17(15(2)27-31(30)24(3,4)5)21-18(12-14)23(29)28(6)22(26-21)20-13-16-9-7-8-10-19(16)25-20/h7-13,25H,1-6H3 |
| InChIKey | RUKXHDQROLADCQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|