C20H27FN4O3S — CID 175998933
tert-butyl-[1-(5-fluoro-3,6-dimethyl-2-morpholin-4-yl-4-oxoquinazolin-8-yl)ethylideneamino]-oxidosulfanium (PubChem CID 175998933) has the molecular formula C20H27FN4O3S and a molecular weight of 422.53 g/mol. Its IUPAC name is tert-butyl-[1-(5-fluoro-3,6-dimethyl-2-morpholin-4-yl-4-oxoquinazolin-8-yl)ethylideneamino]-oxidosulfanium.
| Compound Name | tert-butyl-[1-(5-fluoro-3,6-dimethyl-2-morpholin-4-yl-4-oxoquinazolin-8-yl)ethylideneamino]-oxidosulfanium |
|---|---|
| PubChem CID | 175998933 |
| Molecular Formula | C20H27FN4O3S |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | tert-butyl-[1-(5-fluoro-3,6-dimethyl-2-morpholin-4-yl-4-oxoquinazolin-8-yl)ethylideneamino]-oxidosulfanium |
| SMILES | CC(=N[S+]([O-])C(C)(C)C)c1cc(C)c(F)c2c(=O)n(C)c(N3CCOCC3)nc12 |
| InChI | InChI=1S/C20H27FN4O3S/c1-12-11-14(13(2)23-29(27)20(3,4)5)17-15(16(12)21)18(26)24(6)19(22-17)25-7-9-28-10-8-25/h11H,7-10H2,1-6H3 |
| InChIKey | CVYJYQVURCHBQR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|