About [bis(furan-3-yl)-λ3-iodanyl] methyl sulfate
[bis(furan-3-yl)-λ3-iodanyl] methyl sulfate (PubChem CID 176653925) has the molecular formula C9H9IO6S
and a molecular weight of 372.14 g/mol. Its IUPAC name is [bis(furan-3-yl)-λ3-iodanyl] methyl sulfate.
Molecular Properties
| Compound Name | [bis(furan-3-yl)-λ3-iodanyl] methyl sulfate |
| PubChem CID | 176653925 |
| Molecular Formula | C9H9IO6S |
| Molecular Weight | 372.14 g/mol |
| Exact Mass | 371.92 |
| IUPAC Name | [bis(furan-3-yl)-λ3-iodanyl] methyl sulfate |
| SMILES | COS(=O)(=O)OI(c1ccoc1)c1ccoc1 |
| InChI | InChI=1S/C9H9IO6S/c1-13-17(11,12)16-10(8-2-4-14-6-8)9-3-5-15-7-9/h2-7H,1H3 |
| InChIKey | SRTFGXDZTBEXAH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.14 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [bis(furan-3-yl)-λ3-iodanyl] methyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [bis(furan-3-yl)-λ3-iodanyl] methyl sulfate?
The IUPAC name of [bis(furan-3-yl)-λ3-iodanyl] methyl sulfate (CID 176653925) is [bis(furan-3-yl)-λ3-iodanyl] methyl sulfate.
What is the SMILES notation for [bis(furan-3-yl)-λ3-iodanyl] methyl sulfate?
The canonical SMILES for [bis(furan-3-yl)-λ3-iodanyl] methyl sulfate is COS(=O)(=O)OI(c1ccoc1)c1ccoc1.
What is the InChIKey of [bis(furan-3-yl)-λ3-iodanyl] methyl sulfate?
The InChIKey is SRTFGXDZTBEXAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9IO6S/c1-13-17(11,12)16-10(8-2-4-14-6-8)9-3-5-15-7-9/h2-7H,1H3.
What are the key properties of [bis(furan-3-yl)-λ3-iodanyl] methyl sulfate?
[bis(furan-3-yl)-λ3-iodanyl] methyl sulfate has a molecular weight of 372.14 g/mol, XLogP of 2.24, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [bis(furan-3-yl)-λ3-iodanyl] methyl sulfate is sourced from PubChem (CID 176653925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).