C18H23N3O4 — CID 176654002
(2R,3R)-3-methoxy-2-methyl-N-[2-(3-methyl-2-nitrophenyl)ethyl]-3-(1H-pyrrol-2-yl)propanamide (PubChem CID 176654002) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is (2R,3R)-3-methoxy-2-methyl-N-[2-(3-methyl-2-nitrophenyl)ethyl]-3-(1H-pyrrol-2-yl)propanamide.
| Compound Name | (2R,3R)-3-methoxy-2-methyl-N-[2-(3-methyl-2-nitrophenyl)ethyl]-3-(1H-pyrrol-2-yl)propanamide |
|---|---|
| PubChem CID | 176654002 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (2R,3R)-3-methoxy-2-methyl-N-[2-(3-methyl-2-nitrophenyl)ethyl]-3-(1H-pyrrol-2-yl)propanamide |
| SMILES | CO[C@@H](c1ccc[nH]1)[C@@H](C)C(=O)NCCc1cccc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H23N3O4/c1-12-6-4-7-14(16(12)21(23)24)9-11-20-18(22)13(2)17(25-3)15-8-5-10-19-15/h4-8,10,13,17,19H,9,11H2,1-3H3,(H,20,22)/t13-,17-/m1/s1 |
| InChIKey | MVFAGKZCQKORCV-CXAGYDPISA-N |
| XLogP | 2.91 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|