C25H23N3O5 — CID 176654259
(2R)-2-[(carbamoylamino)-(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-phenylpropanoic acid (PubChem CID 176654259) has the molecular formula C25H23N3O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is (2R)-2-[(carbamoylamino)-(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[(carbamoylamino)-(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 176654259 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | (2R)-2-[(carbamoylamino)-(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-phenylpropanoic acid |
| SMILES | NC(=O)NN(C(=O)OCC1c2ccccc2-c2ccccc21)[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H23N3O5/c26-24(31)27-28(22(23(29)30)14-16-8-2-1-3-9-16)25(32)33-15-21-19-12-6-4-10-17(19)18-11-5-7-13-20(18)21/h1-13,21-22H,14-15H2,(H,29,30)(H3,26,27,31)/t22-/m1/s1 |
| InChIKey | LUCNSTOBKGHOHB-JOCHJYFZSA-N |
| XLogP | 3.52 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|