C28H36N6O — CID 176654993
N-[6-(4-pyrimido[1,2-a]benzimidazol-2-ylpiperazin-1-yl)hexyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 176654993) has the molecular formula C28H36N6O and a molecular weight of 472.64 g/mol. Its IUPAC name is N-[6-(4-pyrimido[1,2-a]benzimidazol-2-ylpiperazin-1-yl)hexyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N-[6-(4-pyrimido[1,2-a]benzimidazol-2-ylpiperazin-1-yl)hexyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 176654993 |
| Molecular Formula | C28H36N6O |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | N-[6-(4-pyrimido[1,2-a]benzimidazol-2-ylpiperazin-1-yl)hexyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(NCCCCCCN1CCN(c2ccn3c(n2)nc2ccccc23)CC1)C1CC2C=CC1C2 |
| InChI | InChI=1S/C28H36N6O/c35-27(23-20-21-9-10-22(23)19-21)29-12-5-1-2-6-13-32-15-17-33(18-16-32)26-11-14-34-25-8-4-3-7-24(25)30-28(34)31-26/h3-4,7-11,14,21-23H,1-2,5-6,12-13,15-20H2,(H,29,35) |
| InChIKey | GDJMPTPOAJWYGS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 65.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|