C22H31NO7 — CID 176655085
tert-butyl 2'-(2-methoxyethoxymethoxy)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 176655085) has the molecular formula C22H31NO7 and a molecular weight of 421.49 g/mol. Its IUPAC name is tert-butyl 2'-(2-methoxyethoxymethoxy)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 2'-(2-methoxyethoxymethoxy)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 176655085 |
| Molecular Formula | C22H31NO7 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | tert-butyl 2'-(2-methoxyethoxymethoxy)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | COCCOCOC1CC2(CCN1C(=O)OC(C)(C)C)CC(=O)c1ccccc1O2 |
| InChI | InChI=1S/C22H31NO7/c1-21(2,3)30-20(25)23-10-9-22(14-19(23)28-15-27-12-11-26-4)13-17(24)16-7-5-6-8-18(16)29-22/h5-8,19H,9-15H2,1-4H3 |
| InChIKey | LGTYCFQXJGMUPQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|