C18H19NO6 — CID 176657369
ethyl 4-[[(E)-1-(2,3,4-trihydroxyphenyl)ethylideneamino]oxymethyl]benzoate (PubChem CID 176657369) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is ethyl 4-[[(E)-1-(2,3,4-trihydroxyphenyl)ethylideneamino]oxymethyl]benzoate.
| Compound Name | ethyl 4-[[(E)-1-(2,3,4-trihydroxyphenyl)ethylideneamino]oxymethyl]benzoate |
|---|---|
| PubChem CID | 176657369 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | ethyl 4-[[(E)-1-(2,3,4-trihydroxyphenyl)ethylideneamino]oxymethyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CO/N=C(\C)c2ccc(O)c(O)c2O)cc1 |
| InChI | InChI=1S/C18H19NO6/c1-3-24-18(23)13-6-4-12(5-7-13)10-25-19-11(2)14-8-9-15(20)17(22)16(14)21/h4-9,20-22H,3,10H2,1-2H3/b19-11+ |
| InChIKey | DDNROQQAPKMDJY-YBFXNURJSA-N |
| XLogP | 2.92 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|