C21H25NO6 — CID 176657362
pentyl 3-[[(E)-1-(2,3,4-trihydroxyphenyl)ethylideneamino]oxymethyl]benzoate (PubChem CID 176657362) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is pentyl 3-[[(E)-1-(2,3,4-trihydroxyphenyl)ethylideneamino]oxymethyl]benzoate.
| Compound Name | pentyl 3-[[(E)-1-(2,3,4-trihydroxyphenyl)ethylideneamino]oxymethyl]benzoate |
|---|---|
| PubChem CID | 176657362 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | pentyl 3-[[(E)-1-(2,3,4-trihydroxyphenyl)ethylideneamino]oxymethyl]benzoate |
| SMILES | CCCCCOC(=O)c1cccc(CO/N=C(\C)c2ccc(O)c(O)c2O)c1 |
| InChI | InChI=1S/C21H25NO6/c1-3-4-5-11-27-21(26)16-8-6-7-15(12-16)13-28-22-14(2)17-9-10-18(23)20(25)19(17)24/h6-10,12,23-25H,3-5,11,13H2,1-2H3/b22-14+ |
| InChIKey | VHKKXNKXUPRKCR-HYARGMPZSA-N |
| XLogP | 4.09 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|