C18H17NO4 — CID 176657438
2-[4-(1,3-dihydroxyisoindol-2-yl)phenyl]butanoic acid (PubChem CID 176657438) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-[4-(1,3-dihydroxyisoindol-2-yl)phenyl]butanoic acid.
| Compound Name | 2-[4-(1,3-dihydroxyisoindol-2-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 176657438 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-[4-(1,3-dihydroxyisoindol-2-yl)phenyl]butanoic acid |
| SMILES | CCC(C(=O)O)c1ccc(-n2c(O)c3ccccc3c2O)cc1 |
| InChI | InChI=1S/C18H17NO4/c1-2-13(18(22)23)11-7-9-12(10-8-11)19-16(20)14-5-3-4-6-15(14)17(19)21/h3-10,13,20-21H,2H2,1H3,(H,22,23) |
| InChIKey | LSQVOWRNXXSBHX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |