C24H26ClN3O4S — CID 176659881
[2-[(2-cyclopentyl-1-oxo-3H-isoindol-5-yl)oxy]ethanimidoyl] 4-chloro-3-formylbenzenecarboximidothioate;methanol (PubChem CID 176659881) has the molecular formula C24H26ClN3O4S and a molecular weight of 488.01 g/mol. Its IUPAC name is [2-[(2-cyclopentyl-1-oxo-3H-isoindol-5-yl)oxy]ethanimidoyl] 4-chloro-3-formylbenzenecarboximidothioate;methanol.
| Compound Name | [2-[(2-cyclopentyl-1-oxo-3H-isoindol-5-yl)oxy]ethanimidoyl] 4-chloro-3-formylbenzenecarboximidothioate;methanol |
|---|---|
| PubChem CID | 176659881 |
| Molecular Formula | C24H26ClN3O4S |
| Molecular Weight | 488.01 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | [2-[(2-cyclopentyl-1-oxo-3H-isoindol-5-yl)oxy]ethanimidoyl] 4-chloro-3-formylbenzenecarboximidothioate;methanol |
| SMILES | CO.[H]/N=C(/COc1ccc2c(c1)CN(C1CCCC1)C2=O)S/C(=N/[H])c1ccc(Cl)c(C=O)c1 |
| InChI | InChI=1S/C23H22ClN3O3S.CH4O/c24-20-8-5-14(9-16(20)12-28)22(26)31-21(25)13-30-18-6-7-19-15(10-18)11-27(23(19)29)17-3-1-2-4-17;1-2/h5-10,12,17,25-26H,1-4,11,13H2;2H,1H3/b25-21-,26-22+; |
| InChIKey | QOZORRLHKAQGOV-ALMBIWOOSA-N |
| XLogP | 4.77 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.01 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|