C13H17F10NO2 — CID 176661157
1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-ol;2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethyl hypofluorite (PubChem CID 176661157) has the molecular formula C13H17F10NO2 and a molecular weight of 409.26 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-ol;2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethyl hypofluorite.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-ol;2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethyl hypofluorite |
|---|---|
| PubChem CID | 176661157 |
| Molecular Formula | C13H17F10NO2 |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-ol;2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethyl hypofluorite |
| SMILES | FOCC12CCCCN1CCC2.OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H16FNO.C4HF9O/c10-12-8-9-4-1-2-6-11(9)7-3-5-9;5-2(6,7)1(14,3(8,9)10)4(11,12)13/h1-8H2;14H |
| InChIKey | SBLOCSVFVWHMJO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |