About 2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethyl hypofluorite
2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethyl hypofluorite (PubChem CID 176661158) has the molecular formula C9H16FNO
and a molecular weight of 173.23 g/mol. Its IUPAC name is 2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethyl hypofluorite.
Analyze 2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethyl hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethyl hypofluorite?
The IUPAC name of 2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethyl hypofluorite (CID 176661158) is 2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethyl hypofluorite.
What is the SMILES notation for 2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethyl hypofluorite?
The canonical SMILES for 2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethyl hypofluorite is FOCC12CCCCN1CCC2.
What is the InChIKey of 2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethyl hypofluorite?
The InChIKey is UEKPBXGIWDATHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16FNO/c10-12-8-9-4-1-2-6-11(9)7-3-5-9/h1-8H2.
What are the key properties of 2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethyl hypofluorite?
2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethyl hypofluorite has a molecular weight of 173.23 g/mol, XLogP of 1.91, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethyl hypofluorite is sourced from PubChem (CID 176661158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).