C25H37F5N2O — CID 176663334
4,4-difluoro-N-[4-[3-[(4Z,6E)-8,8,8-trifluoro-2,7-dimethylocta-2,4,6-trien-3-yl]pyrrolidin-1-yl]butyl]cyclohexane-1-carboxamide (PubChem CID 176663334) has the molecular formula C25H37F5N2O and a molecular weight of 476.57 g/mol. Its IUPAC name is 4,4-difluoro-N-[4-[3-[(4Z,6E)-8,8,8-trifluoro-2,7-dimethylocta-2,4,6-trien-3-yl]pyrrolidin-1-yl]butyl]cyclohexane-1-carboxamide.
| Compound Name | 4,4-difluoro-N-[4-[3-[(4Z,6E)-8,8,8-trifluoro-2,7-dimethylocta-2,4,6-trien-3-yl]pyrrolidin-1-yl]butyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 176663334 |
| Molecular Formula | C25H37F5N2O |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | 4,4-difluoro-N-[4-[3-[(4Z,6E)-8,8,8-trifluoro-2,7-dimethylocta-2,4,6-trien-3-yl]pyrrolidin-1-yl]butyl]cyclohexane-1-carboxamide |
| SMILES | CC(C)=C(/C=C\C=C(/C)C(F)(F)F)C1CCN(CCCCNC(=O)C2CCC(F)(F)CC2)C1 |
| InChI | InChI=1S/C25H37F5N2O/c1-18(2)22(8-6-7-19(3)25(28,29)30)21-11-16-32(17-21)15-5-4-14-31-23(33)20-9-12-24(26,27)13-10-20/h6-8,20-21H,4-5,9-17H2,1-3H3,(H,31,33)/b8-6-,19-7+ |
| InChIKey | KGQAHXXEOKZRDI-VGIFIUIKSA-N |
| XLogP | 6.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|