C10H14F2N2 — CID 176663647
3-[(2R)-3,3-difluoropent-4-en-2-yl]-2,3-dihydropyridin-2-amine (PubChem CID 176663647) has the molecular formula C10H14F2N2 and a molecular weight of 200.23 g/mol. Its IUPAC name is 3-[(2R)-3,3-difluoropent-4-en-2-yl]-2,3-dihydropyridin-2-amine.
| Compound Name | 3-[(2R)-3,3-difluoropent-4-en-2-yl]-2,3-dihydropyridin-2-amine |
|---|---|
| PubChem CID | 176663647 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 3-[(2R)-3,3-difluoropent-4-en-2-yl]-2,3-dihydropyridin-2-amine |
| SMILES | C=CC(F)(F)[C@H](C)C1C=CC=NC1N |
| InChI | InChI=1S/C10H14F2N2/c1-3-10(11,12)7(2)8-5-4-6-14-9(8)13/h3-9H,1,13H2,2H3/t7-,8?,9?/m1/s1 |
| InChIKey | ISZNVBKCGYGGSO-AFPNSQJFSA-N |
| XLogP | 1.99 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|