C9H14F3N3 — CID 154315144
3-(4,4,4-trifluorobutyl)-2H-pyridine-2,3-diamine (PubChem CID 154315144) has the molecular formula C9H14F3N3 and a molecular weight of 221.23 g/mol. Its IUPAC name is 3-(4,4,4-trifluorobutyl)-2H-pyridine-2,3-diamine.
| Compound Name | 3-(4,4,4-trifluorobutyl)-2H-pyridine-2,3-diamine |
|---|---|
| PubChem CID | 154315144 |
| Molecular Formula | C9H14F3N3 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 3-(4,4,4-trifluorobutyl)-2H-pyridine-2,3-diamine |
| SMILES | NC1N=CC=CC1(N)CCCC(F)(F)F |
| InChI | InChI=1S/C9H14F3N3/c10-9(11,12)5-1-3-8(14)4-2-6-15-7(8)13/h2,4,6-7H,1,3,5,13-14H2 |
| InChIKey | QAEKYIDSJPZGKQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |