C10H19N3 — CID 151850261
3-(3-methylbutyl)-2H-pyridine-2,3-diamine (PubChem CID 151850261) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 3-(3-methylbutyl)-2H-pyridine-2,3-diamine.
| Compound Name | 3-(3-methylbutyl)-2H-pyridine-2,3-diamine |
|---|---|
| PubChem CID | 151850261 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 3-(3-methylbutyl)-2H-pyridine-2,3-diamine |
| SMILES | CC(C)CCC1(N)C=CC=NC1N |
| InChI | InChI=1S/C10H19N3/c1-8(2)4-6-10(12)5-3-7-13-9(10)11/h3,5,7-9H,4,6,11-12H2,1-2H3 |
| InChIKey | SINHQIADYUUVMY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |