C9H17F2NO2S — CID 176666115
(2S)-1-(difluoromethylsulfonyl)-2-methyl-4-propan-2-ylpyrrolidine (PubChem CID 176666115) has the molecular formula C9H17F2NO2S and a molecular weight of 241.30 g/mol. Its IUPAC name is (2S)-1-(difluoromethylsulfonyl)-2-methyl-4-propan-2-ylpyrrolidine.
| Compound Name | (2S)-1-(difluoromethylsulfonyl)-2-methyl-4-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 176666115 |
| Molecular Formula | C9H17F2NO2S |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | (2S)-1-(difluoromethylsulfonyl)-2-methyl-4-propan-2-ylpyrrolidine |
| SMILES | CC(C)C1C[C@H](C)N(S(=O)(=O)C(F)F)C1 |
| InChI | InChI=1S/C9H17F2NO2S/c1-6(2)8-4-7(3)12(5-8)15(13,14)9(10)11/h6-9H,4-5H2,1-3H3/t7-,8?/m0/s1 |
| InChIKey | PJQHBFVBUKEZEO-JAMMHHFISA-N |
| XLogP | 1.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |