C10H10F3NO3S — CID 176667024
methyl 5-(2-hydroxyethylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 176667024) has the molecular formula C10H10F3NO3S and a molecular weight of 281.25 g/mol. Its IUPAC name is methyl 5-(2-hydroxyethylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxylate.
| Compound Name | methyl 5-(2-hydroxyethylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 176667024 |
| Molecular Formula | C10H10F3NO3S |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | methyl 5-(2-hydroxyethylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(C(F)(F)F)c(SCCO)c1 |
| InChI | InChI=1S/C10H10F3NO3S/c1-17-9(16)6-4-7(18-3-2-15)8(14-5-6)10(11,12)13/h4-5,15H,2-3H2,1H3 |
| InChIKey | BCERXEMBMIQSSW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |