C36H25F3N2O — CID 176668756
10-[5-methyl-4-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenoxazine (PubChem CID 176668756) has the molecular formula C36H25F3N2O and a molecular weight of 558.60 g/mol. Its IUPAC name is 10-[5-methyl-4-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenoxazine.
| Compound Name | 10-[5-methyl-4-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenoxazine |
|---|---|
| PubChem CID | 176668756 |
| Molecular Formula | C36H25F3N2O |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | 10-[5-methyl-4-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenoxazine |
| SMILES | Cc1ccc(-c2cc(-c3ccc(C(F)(F)F)cc3)nc3c(N4c5ccccc5Oc5ccccc54)ccc(C)c23)cc1 |
| InChI | InChI=1S/C36H25F3N2O/c1-22-11-14-24(15-12-22)27-21-28(25-16-18-26(19-17-25)36(37,38)39)40-35-31(20-13-23(2)34(27)35)41-29-7-3-5-9-32(29)42-33-10-6-4-8-30(33)41/h3-21H,1-2H3 |
| InChIKey | VWTHVILYFOJJGO-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |