C33H21F3N2OS — CID 176668900
10-[5-methyl-4-thiophen-2-yl-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenoxazine (PubChem CID 176668900) has the molecular formula C33H21F3N2OS and a molecular weight of 550.61 g/mol. Its IUPAC name is 10-[5-methyl-4-thiophen-2-yl-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenoxazine.
| Compound Name | 10-[5-methyl-4-thiophen-2-yl-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenoxazine |
|---|---|
| PubChem CID | 176668900 |
| Molecular Formula | C33H21F3N2OS |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 10-[5-methyl-4-thiophen-2-yl-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenoxazine |
| SMILES | Cc1ccc(N2c3ccccc3Oc3ccccc32)c2nc(-c3ccc(C(F)(F)F)cc3)cc(-c3cccs3)c12 |
| InChI | InChI=1S/C33H21F3N2OS/c1-20-12-17-27(38-25-7-2-4-9-28(25)39-29-10-5-3-8-26(29)38)32-31(20)23(30-11-6-18-40-30)19-24(37-32)21-13-15-22(16-14-21)33(34,35)36/h2-19H,1H3 |
| InChIKey | BTGBRAWQGLIUOJ-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |