C15H20B2N6O — CID 176671233
CID 176671233 (PubChem CID 176671233) has the molecular formula C15H20B2N6O and a molecular weight of 321.99 g/mol.
| Compound Name | CID 176671233 |
|---|---|
| PubChem CID | 176671233 |
| Molecular Formula | C15H20B2N6O |
| Molecular Weight | 321.99 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)Nc1nc(NC2CCNCC2)nc2nc(C)cc(C)c12 |
| InChI | InChI=1S/C15H20B2N6O/c1-8-7-9(2)19-12-11(8)13(23-15(16,17)24)22-14(21-12)20-10-3-5-18-6-4-10/h7,10,18,24H,3-6H2,1-2H3,(H2,19,20,21,22,23) |
| InChIKey | FYSCOLNPHJVUCT-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.99 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|