C10H18FmN3O5- — CID 176672168
N-[2-[ethyl(methyl)amino]-2-oxoethyl]-N-methyl-2-(oxomethylamino)acetamide;fermium;formic acid (PubChem CID 176672168) has the molecular formula C10H18FmN3O5- and a molecular weight of 517.27 g/mol. Its IUPAC name is N-[2-[ethyl(methyl)amino]-2-oxoethyl]-N-methyl-2-(oxomethylamino)acetamide;fermium;formic acid.
| Compound Name | N-[2-[ethyl(methyl)amino]-2-oxoethyl]-N-methyl-2-(oxomethylamino)acetamide;fermium;formic acid |
|---|---|
| PubChem CID | 176672168 |
| Molecular Formula | C10H18FmN3O5- |
| Molecular Weight | 517.27 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | N-[2-[ethyl(methyl)amino]-2-oxoethyl]-N-methyl-2-(oxomethylamino)acetamide;fermium;formic acid |
| SMILES | CCN(C)C(=O)CN(C)C(=O)CN[C-]=O.O=CO.[Fm] |
| InChI | InChI=1S/C9H16N3O3.CH2O2.Fm/c1-4-11(2)9(15)6-12(3)8(14)5-10-7-13;2-1-3;/h4-6H2,1-3H3,(H,10,13);1H,(H,2,3);/q-1;; |
| InChIKey | COZGFDJOLQBHDE-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.27 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|